C20H28O7S — CID 134834413
3-(6-methyl-1,4,8,11-tetraoxadispiro[4.1.47.25]tridecan-6-yl)propyl 4-methylbenzenesulfonate (PubChem CID 134834413) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-(6-methyl-1,4,8,11-tetraoxadispiro[4.1.47.25]tridecan-6-yl)propyl 4-methylbenzenesulfonate.
| Compound Name | 3-(6-methyl-1,4,8,11-tetraoxadispiro[4.1.47.25]tridecan-6-yl)propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134834413 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-(6-methyl-1,4,8,11-tetraoxadispiro[4.1.47.25]tridecan-6-yl)propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC2(C)C3(CCC24OCCO4)OCCO3)cc1 |
| InChI | InChI=1S/C20H28O7S/c1-16-4-6-17(7-5-16)28(21,22)27-11-3-8-18(2)19(23-12-13-24-19)9-10-20(18)25-14-15-26-20/h4-7H,3,8-15H2,1-2H3 |
| InChIKey | FUHPKCDTMXFUHU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|