C19H28O8S — CID 15613120
[(2S)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 15613120) has the molecular formula C19H28O8S and a molecular weight of 416.49 g/mol. Its IUPAC name is [(2S)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15613120 |
| Molecular Formula | C19H28O8S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [(2S)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H28O8S/c1-12-6-8-13(9-7-12)28(21,22)24-10-14(20)16-17(27-19(4,5)26-16)15-11-23-18(2,3)25-15/h6-9,14-17,20H,10-11H2,1-5H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | KVSYTPVWMYDSPG-YLFCFFPRSA-N |
| XLogP | 1.73 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|