C16H30O8 — CID 134834951
ethyl (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enoate (PubChem CID 134834951) has the molecular formula C16H30O8 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enoate.
| Compound Name | ethyl (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enoate |
|---|---|
| PubChem CID | 134834951 |
| Molecular Formula | C16H30O8 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | ethyl (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](OCOC)[C@H](OCOC)[C@@H](C)OCOC |
| InChI | InChI=1S/C16H30O8/c1-6-21-15(17)9-7-8-14(23-11-19-4)16(24-12-20-5)13(2)22-10-18-3/h7,9,13-14,16H,6,8,10-12H2,1-5H3/b9-7+/t13-,14-,16-/m1/s1 |
| InChIKey | BRKGRGYFDWAJNF-LMZSTALFSA-N |
| XLogP | 1.48 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|