C25H37NO5 — CID 134834960
tert-butyl (2S,4aR,8R,8aR)-8-[(1R,4aR,8aR)-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-2-methyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinoline-1-carboxylate (PubChem CID 134834960) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl (2S,4aR,8R,8aR)-8-[(1R,4aR,8aR)-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-2-methyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinoline-1-carboxylate.
| Compound Name | tert-butyl (2S,4aR,8R,8aR)-8-[(1R,4aR,8aR)-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-2-methyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 134834960 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl (2S,4aR,8R,8aR)-8-[(1R,4aR,8aR)-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-2-methyl-6-oxo-2,3,4,4a,5,7,8,8a-octahydroquinoline-1-carboxylate |
| SMILES | C[C@H]1CC[C@@H]2CC(=O)C[C@H]([C@@H]3C(=O)CC(=O)[C@@H]4CCCC[C@@H]34)[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37NO5/c1-14-9-10-15-11-16(27)12-19(23(15)26(14)24(30)31-25(2,3)4)22-18-8-6-5-7-17(18)20(28)13-21(22)29/h14-15,17-19,22-23H,5-13H2,1-4H3/t14-,15+,17+,18+,19+,22+,23+/m0/s1 |
| InChIKey | IETWUGWOTNROLR-NYVNDTCHSA-N |
| XLogP | 4.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|