C7H16ClNO — CID 134835466
(1R,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride (PubChem CID 134835466) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is (1R,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride.
| Compound Name | (1R,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 134835466 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (1R,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride |
| SMILES | C[C@H]1[C@H](O)CCC[C@@H]1N.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-5-6(8)3-2-4-7(5)9;/h5-7,9H,2-4,8H2,1H3;1H/t5-,6+,7-;/m1./s1 |
| InChIKey | BXGXDXVPVPXOST-FNCXLRSCSA-N |
| XLogP | 0.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |