C18H25NO6 — CID 134835555
(6R,8aS)-6-methoxy-7-morpholin-4-yl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 134835555) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (6R,8aS)-6-methoxy-7-morpholin-4-yl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6R,8aS)-6-methoxy-7-morpholin-4-yl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 134835555 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (6R,8aS)-6-methoxy-7-morpholin-4-yl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(O)C1N1CCOCC1 |
| InChI | InChI=1S/C18H25NO6/c1-21-18-14(19-7-9-22-10-8-19)15(20)16-13(24-18)11-23-17(25-16)12-5-3-2-4-6-12/h2-6,13-18,20H,7-11H2,1H3/t13?,14?,15?,16-,17?,18-/m1/s1 |
| InChIKey | CUSOSLDIDXAGNG-YBHZCIPISA-N |
| XLogP | 0.53 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |