C14H13F3O3S — CID 134835809
ethyl 2-[(E)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-enyl]sulfanylacetate (PubChem CID 134835809) has the molecular formula C14H13F3O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is ethyl 2-[(E)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-enyl]sulfanylacetate.
| Compound Name | ethyl 2-[(E)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-enyl]sulfanylacetate |
|---|---|
| PubChem CID | 134835809 |
| Molecular Formula | C14H13F3O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | ethyl 2-[(E)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-enyl]sulfanylacetate |
| SMILES | CCOC(=O)CS/C(=C/C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H13F3O3S/c1-2-20-13(19)9-21-11(8-12(18)14(15,16)17)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3/b11-8+ |
| InChIKey | UMTDMBPEAZCAQL-DHZHZOJOSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|