C20H20N2S — CID 134836400
2-[(2S,3S)-2-deuterio-3-phenyl-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-methyl-1,3-thiazole (PubChem CID 134836400) has the molecular formula C20H20N2S and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-[(2S,3S)-2-deuterio-3-phenyl-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2S,3S)-2-deuterio-3-phenyl-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 134836400 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[(2S,3S)-2-deuterio-3-phenyl-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-methyl-1,3-thiazole |
| SMILES | [2H][C@@]1(c2nc(C)cs2)[C@H](c2ccccc2)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H20N2S/c1-14-13-23-20(21-14)19-18(17-11-7-4-8-12-17)22(19)15(2)16-9-5-3-6-10-16/h3-13,15,18-19H,1-2H3/t15-,18-,19-,22?/m0/s1/i19D |
| InChIKey | MZYPKHAZUZGWIE-SQZTWQLVSA-N |
| XLogP | 5.31 |
| TPSA | 15.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|