C22H25N3S — CID 12050200
1-benzyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-4-amine (PubChem CID 12050200) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-benzyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 12050200 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-benzyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(NCc3csc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3S/c1-3-7-18(8-4-1)16-25-13-11-20(12-14-25)23-15-21-17-26-22(24-21)19-9-5-2-6-10-19/h1-10,17,20,23H,11-16H2 |
| InChIKey | LDOTVWGSWWUMAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |