C33H26O4 — CID 134836560
(2R,4S)-1-naphthalen-1-yl-2,4-diphenoxy-5-phenylpentane-1,5-dione (PubChem CID 134836560) has the molecular formula C33H26O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is (2R,4S)-1-naphthalen-1-yl-2,4-diphenoxy-5-phenylpentane-1,5-dione.
| Compound Name | (2R,4S)-1-naphthalen-1-yl-2,4-diphenoxy-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 134836560 |
| Molecular Formula | C33H26O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2R,4S)-1-naphthalen-1-yl-2,4-diphenoxy-5-phenylpentane-1,5-dione |
| SMILES | O=C(c1ccccc1)[C@H](C[C@@H](Oc1ccccc1)C(=O)c1cccc2ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C33H26O4/c34-32(25-14-4-1-5-15-25)30(36-26-17-6-2-7-18-26)23-31(37-27-19-8-3-9-20-27)33(35)29-22-12-16-24-13-10-11-21-28(24)29/h1-22,30-31H,23H2/t30-,31+/m0/s1 |
| InChIKey | YRDUGUXGQCLTGB-IOWSJCHKSA-N |
| XLogP | 7.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |