C24H18 — CID 134836669
1-but-3-ynyl-2-[4-(2-but-3-ynylphenyl)buta-1,3-diynyl]benzene (PubChem CID 134836669) has the molecular formula C24H18 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-but-3-ynyl-2-[4-(2-but-3-ynylphenyl)buta-1,3-diynyl]benzene.
| Compound Name | 1-but-3-ynyl-2-[4-(2-but-3-ynylphenyl)buta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 134836669 |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-but-3-ynyl-2-[4-(2-but-3-ynylphenyl)buta-1,3-diynyl]benzene |
| SMILES | C#CCCc1ccccc1C#CC#Cc1ccccc1CCC#C |
| InChI | InChI=1S/C24H18/c1-3-5-13-21-15-7-9-17-23(21)19-11-12-20-24-18-10-8-16-22(24)14-6-4-2/h1-2,7-10,15-18H,5-6,13-14H2 |
| InChIKey | IEAXIXWEVKVXQS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|