About 1-phenylhept-6-yn-3-ol
1-phenylhept-6-yn-3-ol (PubChem CID 63657298) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-phenylhept-6-yn-3-ol.
Molecular Properties
| Compound Name | 1-phenylhept-6-yn-3-ol |
| PubChem CID | 63657298 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-phenylhept-6-yn-3-ol |
| SMILES | C#CCCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-2-3-9-13(14)11-10-12-7-5-4-6-8-12/h1,4-8,13-14H,3,9-11H2 |
| InChIKey | MSSIWKKKXCAYPA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhept-6-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhept-6-yn-3-ol?
The IUPAC name of 1-phenylhept-6-yn-3-ol (CID 63657298) is 1-phenylhept-6-yn-3-ol.
What is the SMILES notation for 1-phenylhept-6-yn-3-ol?
The canonical SMILES for 1-phenylhept-6-yn-3-ol is C#CCCC(O)CCc1ccccc1.
What is the InChIKey of 1-phenylhept-6-yn-3-ol?
The InChIKey is MSSIWKKKXCAYPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-2-3-9-13(14)11-10-12-7-5-4-6-8-12/h1,4-8,13-14H,3,9-11H2.
What are the key properties of 1-phenylhept-6-yn-3-ol?
1-phenylhept-6-yn-3-ol has a molecular weight of 188.27 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhept-6-yn-3-ol is sourced from PubChem (CID 63657298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).