C17H28O5 — CID 134836853
(1R)-1-[(2S,4R,6R,10R)-4,10-dimethyl-8-(2-oxopropyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxypropan-2-one (PubChem CID 134836853) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1R)-1-[(2S,4R,6R,10R)-4,10-dimethyl-8-(2-oxopropyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxypropan-2-one.
| Compound Name | (1R)-1-[(2S,4R,6R,10R)-4,10-dimethyl-8-(2-oxopropyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 134836853 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (1R)-1-[(2S,4R,6R,10R)-4,10-dimethyl-8-(2-oxopropyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxypropan-2-one |
| SMILES | CC(=O)CC1C[C@@H](C)C[C@@]2(C[C@H](C)C[C@@H]([C@@H](O)C(C)=O)O2)O1 |
| InChI | InChI=1S/C17H28O5/c1-10-5-14(7-12(3)18)21-17(8-10)9-11(2)6-15(22-17)16(20)13(4)19/h10-11,14-16,20H,5-9H2,1-4H3/t10-,11-,14?,15+,16+,17-/m1/s1 |
| InChIKey | SWTBPCRTTHRGCU-TYHKBMIQSA-N |
| XLogP | 2.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |