C15H28O3Si — CID 134836931
1-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxycyclohex-3-en-1-yl]ethanone (PubChem CID 134836931) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is 1-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxycyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxycyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 134836931 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxycyclohex-3-en-1-yl]ethanone |
| SMILES | CO[C@H]1C=C(O[Si](C)(C)C(C)(C)C)CCC1C(C)=O |
| InChI | InChI=1S/C15H28O3Si/c1-11(16)13-9-8-12(10-14(13)17-5)18-19(6,7)15(2,3)4/h10,13-14H,8-9H2,1-7H3/t13?,14-/m0/s1 |
| InChIKey | SAPAZJQCUORRGA-KZUDCZAMSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|