About 2-hex-1-ynyl-1,3-dimethylcyclohexene
2-hex-1-ynyl-1,3-dimethylcyclohexene (PubChem CID 134837051) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 2-hex-1-ynyl-1,3-dimethylcyclohexene.
Molecular Properties
| Compound Name | 2-hex-1-ynyl-1,3-dimethylcyclohexene |
| PubChem CID | 134837051 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2-hex-1-ynyl-1,3-dimethylcyclohexene |
| SMILES | CCCCC#CC1=C(C)CCCC1C |
| InChI | InChI=1S/C14H22/c1-4-5-6-7-11-14-12(2)9-8-10-13(14)3/h12H,4-6,8-10H2,1-3H3 |
| InChIKey | UCNNGTCBAVZJJS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-1-ynyl-1,3-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-1-ynyl-1,3-dimethylcyclohexene?
The IUPAC name of 2-hex-1-ynyl-1,3-dimethylcyclohexene (CID 134837051) is 2-hex-1-ynyl-1,3-dimethylcyclohexene.
What is the SMILES notation for 2-hex-1-ynyl-1,3-dimethylcyclohexene?
The canonical SMILES for 2-hex-1-ynyl-1,3-dimethylcyclohexene is CCCCC#CC1=C(C)CCCC1C.
What is the InChIKey of 2-hex-1-ynyl-1,3-dimethylcyclohexene?
The InChIKey is UCNNGTCBAVZJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-4-5-6-7-11-14-12(2)9-8-10-13(14)3/h12H,4-6,8-10H2,1-3H3.
What are the key properties of 2-hex-1-ynyl-1,3-dimethylcyclohexene?
2-hex-1-ynyl-1,3-dimethylcyclohexene has a molecular weight of 190.33 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-1-ynyl-1,3-dimethylcyclohexene is sourced from PubChem (CID 134837051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).