C24H18F3NO2 — CID 134837347
3-benzylidene-4-(4-methoxyphenyl)-1-oxido-2-[4-(trifluoromethyl)phenyl]-2H-azet-1-ium (PubChem CID 134837347) has the molecular formula C24H18F3NO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 3-benzylidene-4-(4-methoxyphenyl)-1-oxido-2-[4-(trifluoromethyl)phenyl]-2H-azet-1-ium.
| Compound Name | 3-benzylidene-4-(4-methoxyphenyl)-1-oxido-2-[4-(trifluoromethyl)phenyl]-2H-azet-1-ium |
|---|---|
| PubChem CID | 134837347 |
| Molecular Formula | C24H18F3NO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-benzylidene-4-(4-methoxyphenyl)-1-oxido-2-[4-(trifluoromethyl)phenyl]-2H-azet-1-ium |
| SMILES | COc1ccc(C2=[N+]([O-])C(c3ccc(C(F)(F)F)cc3)C2=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H18F3NO2/c1-30-20-13-9-18(10-14-20)23-21(15-16-5-3-2-4-6-16)22(28(23)29)17-7-11-19(12-8-17)24(25,26)27/h2-15,22H,1H3 |
| InChIKey | SNHCBIKMJJHNOM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|