C25H24F3NO2 — CID 101424648
(E)-4,4,4-trifluoro-N-methoxy-3-(4-methoxyphenyl)-N-methyl-1,1-diphenylbut-2-en-1-amine (PubChem CID 101424648) has the molecular formula C25H24F3NO2 and a molecular weight of 427.47 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-N-methoxy-3-(4-methoxyphenyl)-N-methyl-1,1-diphenylbut-2-en-1-amine.
| Compound Name | (E)-4,4,4-trifluoro-N-methoxy-3-(4-methoxyphenyl)-N-methyl-1,1-diphenylbut-2-en-1-amine |
|---|---|
| PubChem CID | 101424648 |
| Molecular Formula | C25H24F3NO2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (E)-4,4,4-trifluoro-N-methoxy-3-(4-methoxyphenyl)-N-methyl-1,1-diphenylbut-2-en-1-amine |
| SMILES | COc1ccc(/C(=C\C(c2ccccc2)(c2ccccc2)N(C)OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F3NO2/c1-29(31-3)24(20-10-6-4-7-11-20,21-12-8-5-9-13-21)18-23(25(26,27)28)19-14-16-22(30-2)17-15-19/h4-18H,1-3H3/b23-18+ |
| InChIKey | VVTQJZVLMCIORS-PTGBLXJZSA-N |
| XLogP | 6.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|