C15H23NO6 — CID 134837360
1-O-tert-butyl 2-O-ethyl (2R,3R)-3-acetyloxy-3,6-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 134837360) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-acetyloxy-3,6-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-acetyloxy-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134837360 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-acetyloxy-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](OC(C)=O)C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO6/c1-6-20-13(18)12-11(21-10(2)17)8-7-9-16(12)14(19)22-15(3,4)5/h7-8,11-12H,6,9H2,1-5H3/t11-,12-/m1/s1 |
| InChIKey | QNSITPBWXAVJHW-VXGBXAGGSA-N |
| XLogP | 1.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|