C13H21NO4 — CID 135067324
1-O-tert-butyl 2-O-ethyl 3,6-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 135067324) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 3,6-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135067324 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4/c1-5-17-11(15)10-8-6-7-9-14(10)12(16)18-13(2,3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | MUHKUKAFBYOIEE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|