C19H19NOS — CID 134838001
(NE,R)-N-(anthracen-9-ylmethylidene)-2-methylpropane-2-sulfinamide (PubChem CID 134838001) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is (NE,R)-N-(anthracen-9-ylmethylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-(anthracen-9-ylmethylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134838001 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (NE,R)-N-(anthracen-9-ylmethylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H19NOS/c1-19(2,3)22(21)20-13-18-16-10-6-4-8-14(16)12-15-9-5-7-11-17(15)18/h4-13H,1-3H3/b20-13+/t22-/m1/s1 |
| InChIKey | OPNYMINAQYCWGO-WVWKGNOCSA-N |
| XLogP | 4.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|