C16H17F2NOS — CID 139185409
(NZ,R)-N-(2,2-difluoro-1-naphthalen-2-ylethylidene)-2-methylpropane-2-sulfinamide (PubChem CID 139185409) has the molecular formula C16H17F2NOS and a molecular weight of 309.38 g/mol. Its IUPAC name is (NZ,R)-N-(2,2-difluoro-1-naphthalen-2-ylethylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-(2,2-difluoro-1-naphthalen-2-ylethylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139185409 |
| Molecular Formula | C16H17F2NOS |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (NZ,R)-N-(2,2-difluoro-1-naphthalen-2-ylethylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C(/c1ccc2ccccc2c1)C(F)F |
| InChI | InChI=1S/C16H17F2NOS/c1-16(2,3)21(20)19-14(15(17)18)13-9-8-11-6-4-5-7-12(11)10-13/h4-10,15H,1-3H3/b19-14-/t21-/m1/s1 |
| InChIKey | ALXNDJHSKGXACT-LUDQZLGDSA-N |
| XLogP | 4.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|