C27H29F3O7 — CID 134838272
benzyl (2R)-2-[(2R,5S)-5-[(2R)-2-[(2S)-2-acetyloxy-2-phenylacetyl]oxy-3,3,3-trifluoropropyl]oxolan-2-yl]propanoate (PubChem CID 134838272) has the molecular formula C27H29F3O7 and a molecular weight of 522.52 g/mol. Its IUPAC name is benzyl (2R)-2-[(2R,5S)-5-[(2R)-2-[(2S)-2-acetyloxy-2-phenylacetyl]oxy-3,3,3-trifluoropropyl]oxolan-2-yl]propanoate.
| Compound Name | benzyl (2R)-2-[(2R,5S)-5-[(2R)-2-[(2S)-2-acetyloxy-2-phenylacetyl]oxy-3,3,3-trifluoropropyl]oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 134838272 |
| Molecular Formula | C27H29F3O7 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | benzyl (2R)-2-[(2R,5S)-5-[(2R)-2-[(2S)-2-acetyloxy-2-phenylacetyl]oxy-3,3,3-trifluoropropyl]oxolan-2-yl]propanoate |
| SMILES | CC(=O)O[C@H](C(=O)O[C@H](C[C@@H]1CC[C@H]([C@@H](C)C(=O)OCc2ccccc2)O1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C27H29F3O7/c1-17(25(32)34-16-19-9-5-3-6-10-19)22-14-13-21(36-22)15-23(27(28,29)30)37-26(33)24(35-18(2)31)20-11-7-4-8-12-20/h3-12,17,21-24H,13-16H2,1-2H3/t17-,21+,22-,23-,24+/m1/s1 |
| InChIKey | KNCXLNLLQAZRHJ-UZKJWJASSA-N |
| XLogP | 5.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|