C22H46O5Si3 — CID 134839354
[(4aS,8R,8aS)-2,2-ditert-butyl-6-[hydroxy(dimethyl)silyl]-3,4a,8,8a-tetrahydropyrano[2,3-e][1,4,2]dioxasilin-8-yl]oxy-triethylsilane (PubChem CID 134839354) has the molecular formula C22H46O5Si3 and a molecular weight of 474.86 g/mol. Its IUPAC name is [(4aS,8R,8aS)-2,2-ditert-butyl-6-[hydroxy(dimethyl)silyl]-3,4a,8,8a-tetrahydropyrano[2,3-e][1,4,2]dioxasilin-8-yl]oxy-triethylsilane.
| Compound Name | [(4aS,8R,8aS)-2,2-ditert-butyl-6-[hydroxy(dimethyl)silyl]-3,4a,8,8a-tetrahydropyrano[2,3-e][1,4,2]dioxasilin-8-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134839354 |
| Molecular Formula | C22H46O5Si3 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | [(4aS,8R,8aS)-2,2-ditert-butyl-6-[hydroxy(dimethyl)silyl]-3,4a,8,8a-tetrahydropyrano[2,3-e][1,4,2]dioxasilin-8-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C([Si](C)(C)O)O[C@@H]2OC[Si](C(C)(C)C)(C(C)(C)C)O[C@H]21 |
| InChI | InChI=1S/C22H46O5Si3/c1-12-29(13-2,14-3)26-17-15-18(28(10,11)23)25-20-19(17)27-30(16-24-20,21(4,5)6)22(7,8)9/h15,17,19-20,23H,12-14,16H2,1-11H3/t17-,19+,20+/m1/s1 |
| InChIKey | VHZPPPNYKBOLPO-HOJAQTOUSA-N |
| XLogP | 5.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|