C18H36O4Si — CID 134839543
ethyl (4R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-9-oxononanoate (PubChem CID 134839543) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is ethyl (4R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-9-oxononanoate.
| Compound Name | ethyl (4R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-9-oxononanoate |
|---|---|
| PubChem CID | 134839543 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | ethyl (4R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-9-oxononanoate |
| SMILES | CCOC(=O)CC[C@@H](CCC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-8-21-17(20)13-12-16(11-9-10-15(2)14-19)22-23(6,7)18(3,4)5/h14-16H,8-13H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | STHKYMHKTAZVTL-HZPDHXFCSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|