C11H14Li2N2O — CID 134839602
dilithium;2,2-dimethyl-N-(4H-pyridin-4-id-3-ylmethyl)propanimidate (PubChem CID 134839602) has the molecular formula C11H14Li2N2O and a molecular weight of 204.13 g/mol. Its IUPAC name is dilithium;2,2-dimethyl-N-(4H-pyridin-4-id-3-ylmethyl)propanimidate.
| Compound Name | dilithium;2,2-dimethyl-N-(4H-pyridin-4-id-3-ylmethyl)propanimidate |
|---|---|
| PubChem CID | 134839602 |
| Molecular Formula | C11H14Li2N2O |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | dilithium;2,2-dimethyl-N-(4H-pyridin-4-id-3-ylmethyl)propanimidate |
| SMILES | CC(C)(C)/C([O-])=N/Cc1[c-]ccnc1.[Li+].[Li+] |
| InChI | InChI=1S/C11H15N2O.2Li/c1-11(2,3)10(14)13-8-9-5-4-6-12-7-9;;/h4,6-7H,8H2,1-3H3,(H,13,14);;/q-1;2*+1/p-1 |
| InChIKey | UEZZHBUBESNGDL-UHFFFAOYSA-M |
| XLogP | -4.81 |
| TPSA | 48.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|