C11H15NO3S — CID 58129199
3,3-dimethyl-1-pyridin-3-ylsulfonylbutan-2-one (PubChem CID 58129199) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-pyridin-3-ylsulfonylbutan-2-one.
| Compound Name | 3,3-dimethyl-1-pyridin-3-ylsulfonylbutan-2-one |
|---|---|
| PubChem CID | 58129199 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3,3-dimethyl-1-pyridin-3-ylsulfonylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H15NO3S/c1-11(2,3)10(13)8-16(14,15)9-5-4-6-12-7-9/h4-7H,8H2,1-3H3 |
| InChIKey | TXYRVHGUGKQXJE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |