C17H38O2Si2 — CID 134839850
tert-butyl-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoxy]-dimethylsilane (PubChem CID 134839850) has the molecular formula C17H38O2Si2 and a molecular weight of 330.66 g/mol. Its IUPAC name is tert-butyl-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134839850 |
| Molecular Formula | C17H38O2Si2 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | tert-butyl-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O2Si2/c1-12-15(19-21(10,11)17(5,6)7)13-14-18-20(8,9)16(2,3)4/h12,15H,1,13-14H2,2-11H3/t15-/m0/s1 |
| InChIKey | WKCIGFPFLQEOMV-HNNXBMFYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|