C26H35NO4Si — CID 134840212
tert-butyl N-[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-oxopent-4-en-2-yl]carbamate (PubChem CID 134840212) has the molecular formula C26H35NO4Si and a molecular weight of 453.66 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134840212 |
| Molecular Formula | C26H35NO4Si |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35NO4Si/c1-8-23(22(19-28)27-24(29)30-25(2,3)4)31-32(26(5,6)7,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h8-19,22-23H,1H2,2-7H3,(H,27,29)/t22-,23-/m0/s1 |
| InChIKey | OSHOZZUXWDBTDV-GOTSBHOMSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|