C30H44N2O6Si — CID 10940678
tert-butyl N-[(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl]carbamate (PubChem CID 10940678) has the molecular formula C30H44N2O6Si and a molecular weight of 556.78 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10940678 |
| Molecular Formula | C30H44N2O6Si |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H44N2O6Si/c1-28(2,3)37-26(34)31-24(20-33)25(32-27(35)38-29(4,5)6)21-36-39(30(7,8)9,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-20,24-25H,21H2,1-9H3,(H,31,34)(H,32,35)/t24-,25+/m1/s1 |
| InChIKey | SBFGFFNQWWLIBH-RPBOFIJWSA-N |
| XLogP | 4.55 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|