C24H34N4O3Si — CID 163408079
tert-butyl N-[(2R)-1-azido-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]carbamate (PubChem CID 163408079) has the molecular formula C24H34N4O3Si and a molecular weight of 454.65 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-azido-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-azido-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 163408079 |
| Molecular Formula | C24H34N4O3Si |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | tert-butyl N-[(2R)-1-azido-3-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN=[N+]=[N-])CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34N4O3Si/c1-23(2,3)31-22(29)27-19(17-26-28-25)18-30-32(24(4,5)6,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19H,17-18H2,1-6H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | AIAHZDOHYDKRSF-LJQANCHMSA-N |
| XLogP | 4.77 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|