C18H34O2Si — CID 134840461
tert-butyl-dimethyl-[[(2E,11E)-1-oxacyclotrideca-2,11-dien-2-yl]oxy]silane (PubChem CID 134840461) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2E,11E)-1-oxacyclotrideca-2,11-dien-2-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2E,11E)-1-oxacyclotrideca-2,11-dien-2-yl]oxy]silane |
|---|---|
| PubChem CID | 134840461 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(2E,11E)-1-oxacyclotrideca-2,11-dien-2-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O/C1=C/CCCCCCC/C=C/CO1 |
| InChI | InChI=1S/C18H34O2Si/c1-18(2,3)21(4,5)20-17-15-13-11-9-7-6-8-10-12-14-16-19-17/h12,14-15H,6-11,13,16H2,1-5H3/b14-12+,17-15+ |
| InChIKey | BRGUJNCHOOHAEG-FAHPUHHFSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|