C24H27NO5S2 — CID 134840619
N-(benzenesulfonyl)-N-[(3-tert-butyl-2-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 134840619) has the molecular formula C24H27NO5S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[(3-tert-butyl-2-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-N-[(3-tert-butyl-2-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134840619 |
| Molecular Formula | C24H27NO5S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-(benzenesulfonyl)-N-[(3-tert-butyl-2-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1c(CN(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cccc1C(C)(C)C |
| InChI | InChI=1S/C24H27NO5S2/c1-24(2,3)22-17-11-12-19(23(22)30-4)18-25(31(26,27)20-13-7-5-8-14-20)32(28,29)21-15-9-6-10-16-21/h5-17H,18H2,1-4H3 |
| InChIKey | FIIDLWMLOGGJIJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |