C16H16N2O3S — CID 134841081
3-(benzenesulfonylmethyl)-1,3-dimethylpyrrolo[2,3-b]pyridin-2-one (PubChem CID 134841081) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-1,3-dimethylpyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 3-(benzenesulfonylmethyl)-1,3-dimethylpyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 134841081 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-1,3-dimethylpyrrolo[2,3-b]pyridin-2-one |
| SMILES | CN1C(=O)C(C)(CS(=O)(=O)c2ccccc2)c2cccnc21 |
| InChI | InChI=1S/C16H16N2O3S/c1-16(11-22(20,21)12-7-4-3-5-8-12)13-9-6-10-17-14(13)18(2)15(16)19/h3-10H,11H2,1-2H3 |
| InChIKey | XITJQFSQIXWYIT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |