C22H23NO8S — CID 134841204
1-[(1R,7R)-4,4-dioxo-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-4λ6-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone (PubChem CID 134841204) has the molecular formula C22H23NO8S and a molecular weight of 461.49 g/mol. Its IUPAC name is 1-[(1R,7R)-4,4-dioxo-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-4λ6-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone.
| Compound Name | 1-[(1R,7R)-4,4-dioxo-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-4λ6-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
|---|---|
| PubChem CID | 134841204 |
| Molecular Formula | C22H23NO8S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-[(1R,7R)-4,4-dioxo-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-4λ6-thia-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]ethanone |
| SMILES | CC(=O)N1C2C(OS1(=O)=O)[C@@H]1OC(c3ccccc3)OCC1O[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO8S/c1-14(24)23-18-20(31-32(23,25)26)19-17(13-28-21(30-19)16-10-6-3-7-11-16)29-22(18)27-12-15-8-4-2-5-9-15/h2-11,17-22H,12-13H2,1H3/t17?,18?,19-,20?,21?,22-/m1/s1 |
| InChIKey | WCLQFTAJSSMLRA-UCUDVLTHSA-N |
| XLogP | 1.90 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |