C11H18O5 — CID 134841247
methyl 3,3-dimethoxy-1-(2-oxoethyl)cyclopentane-1-carboxylate (PubChem CID 134841247) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 3,3-dimethoxy-1-(2-oxoethyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 3,3-dimethoxy-1-(2-oxoethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134841247 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl 3,3-dimethoxy-1-(2-oxoethyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(CC=O)CCC(OC)(OC)C1 |
| InChI | InChI=1S/C11H18O5/c1-14-9(13)10(6-7-12)4-5-11(8-10,15-2)16-3/h7H,4-6,8H2,1-3H3 |
| InChIKey | QXCRSBYUSFKDKZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|