C13H24O4 — CID 59888741
tert-butyl 3,3-dimethoxy-1-methylcyclopentane-1-carboxylate (PubChem CID 59888741) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl 3,3-dimethoxy-1-methylcyclopentane-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethoxy-1-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59888741 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | tert-butyl 3,3-dimethoxy-1-methylcyclopentane-1-carboxylate |
| SMILES | COC1(OC)CCC(C)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H24O4/c1-11(2,3)17-10(14)12(4)7-8-13(9-12,15-5)16-6/h7-9H2,1-6H3 |
| InChIKey | SAVOWENWBADJAE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|