About 5-nitro-2,4-diphenylpyridine
5-nitro-2,4-diphenylpyridine (PubChem CID 134841572) has the molecular formula C17H12N2O2
and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-nitro-2,4-diphenylpyridine.
Molecular Properties
| Compound Name | 5-nitro-2,4-diphenylpyridine |
| PubChem CID | 134841572 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-nitro-2,4-diphenylpyridine |
| SMILES | O=[N+]([O-])c1cnc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H12N2O2/c20-19(21)17-12-18-16(14-9-5-2-6-10-14)11-15(17)13-7-3-1-4-8-13/h1-12H |
| InChIKey | JDXCGDYTHZYIQV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2,4-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2,4-diphenylpyridine?
The IUPAC name of 5-nitro-2,4-diphenylpyridine (CID 134841572) is 5-nitro-2,4-diphenylpyridine.
What is the SMILES notation for 5-nitro-2,4-diphenylpyridine?
The canonical SMILES for 5-nitro-2,4-diphenylpyridine is O=[N+]([O-])c1cnc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of 5-nitro-2,4-diphenylpyridine?
The InChIKey is JDXCGDYTHZYIQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c20-19(21)17-12-18-16(14-9-5-2-6-10-14)11-15(17)13-7-3-1-4-8-13/h1-12H.
What are the key properties of 5-nitro-2,4-diphenylpyridine?
5-nitro-2,4-diphenylpyridine has a molecular weight of 276.30 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2,4-diphenylpyridine is sourced from PubChem (CID 134841572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).