C13H17NO4 — CID 134841761
tert-butyl 1,9-dioxo-2-azaspiro[4.4]non-7-ene-2-carboxylate (PubChem CID 134841761) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is tert-butyl 1,9-dioxo-2-azaspiro[4.4]non-7-ene-2-carboxylate.
| Compound Name | tert-butyl 1,9-dioxo-2-azaspiro[4.4]non-7-ene-2-carboxylate |
|---|---|
| PubChem CID | 134841761 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | tert-butyl 1,9-dioxo-2-azaspiro[4.4]non-7-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC=CC2=O)C1=O |
| InChI | InChI=1S/C13H17NO4/c1-12(2,3)18-11(17)14-8-7-13(10(14)16)6-4-5-9(13)15/h4-5H,6-8H2,1-3H3 |
| InChIKey | VDPNUTPERGXGAP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|