C18H15BrO2 — CID 134842225
2-(9-bromophenanthren-3-yl)-2-methyl-1,3-dioxolane (PubChem CID 134842225) has the molecular formula C18H15BrO2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-(9-bromophenanthren-3-yl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(9-bromophenanthren-3-yl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134842225 |
| Molecular Formula | C18H15BrO2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-(9-bromophenanthren-3-yl)-2-methyl-1,3-dioxolane |
| SMILES | CC1(c2ccc3cc(Br)c4ccccc4c3c2)OCCO1 |
| InChI | InChI=1S/C18H15BrO2/c1-18(20-8-9-21-18)13-7-6-12-10-17(19)15-5-3-2-4-14(15)16(12)11-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | YFANLXVHDUTOIE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|