C12H15F3O6 — CID 134842681
[(3S,6S)-3-acetyloxy-6-(2,2,2-trifluoroethoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134842681) has the molecular formula C12H15F3O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is [(3S,6S)-3-acetyloxy-6-(2,2,2-trifluoroethoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3-acetyloxy-6-(2,2,2-trifluoroethoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134842681 |
| Molecular Formula | C12H15F3O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(3S,6S)-3-acetyloxy-6-(2,2,2-trifluoroethoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](OCC(F)(F)F)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H15F3O6/c1-7(16)18-5-10-9(20-8(2)17)3-4-11(21-10)19-6-12(13,14)15/h3-4,9-11H,5-6H2,1-2H3/t9-,10?,11-/m0/s1 |
| InChIKey | BUBBTWNCMHVILG-JRUYECLLSA-N |
| XLogP | 1.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|