C20H33NO4 — CID 134842785
tert-butyl N-[1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl]-N-prop-2-enylcarbamate (PubChem CID 134842785) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl N-[1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 134842785 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl N-[1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCC([C@H]1COC2(CCCCC2)O1)N(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO4/c1-6-11-16(21(14-7-2)18(22)25-19(3,4)5)17-15-23-20(24-17)12-9-8-10-13-20/h6-7,16-17H,1-2,8-15H2,3-5H3/t16?,17-/m1/s1 |
| InChIKey | PHXWETDRTHTNFS-ZYMOGRSISA-N |
| XLogP | 4.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|