About ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate
ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate (PubChem CID 102299809) has the molecular formula C17H29NO5
and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate |
| PubChem CID | 102299809 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCC)C(OCC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C17H29NO5/c1-4-12-18(16(19)21-6-3)15(20-5-2)14-13-22-17(23-14)10-8-7-9-11-17/h4,14-15H,1,5-13H2,2-3H3/t14-,15?/m1/s1 |
| InChIKey | HDOPCNGTAGBXLZ-GICMACPYSA-N |
| XLogP | 3.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate?
The IUPAC name of ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate (CID 102299809) is ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate.
What is the SMILES notation for ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate?
The canonical SMILES for ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate is C=CCN(C(=O)OCC)C(OCC)[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate?
The InChIKey is HDOPCNGTAGBXLZ-GICMACPYSA-N. The full InChI is InChI=1S/C17H29NO5/c1-4-12-18(16(19)21-6-3)15(20-5-2)14-13-22-17(23-14)10-8-7-9-11-17/h4,14-15H,1,5-13H2,2-3H3/t14-,15?/m1/s1.
What are the key properties of ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate?
ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate has a molecular weight of 327.42 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-ethoxymethyl]-N-prop-2-enylcarbamate is sourced from PubChem (CID 102299809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).