C15H26OSi — CID 134842929
tert-butyl-dimethyl-[(3R)-5-methylideneoct-7-en-1-yn-3-yl]oxysilane (PubChem CID 134842929) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R)-5-methylideneoct-7-en-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R)-5-methylideneoct-7-en-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 134842929 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | tert-butyl-dimethyl-[(3R)-5-methylideneoct-7-en-1-yn-3-yl]oxysilane |
| SMILES | C#C[C@@H](CC(=C)CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26OSi/c1-9-11-13(3)12-14(10-2)16-17(7,8)15(4,5)6/h2,9,14H,1,3,11-12H2,4-8H3/t14-/m0/s1 |
| InChIKey | KKPLYUQQHIMEKD-AWEZNQCLSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|