C21H40OSi — CID 139251427
tert-butyl-dimethyl-[(4S)-pentadec-1-en-14-yn-4-yl]oxysilane (PubChem CID 139251427) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4S)-pentadec-1-en-14-yn-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4S)-pentadec-1-en-14-yn-4-yl]oxysilane |
|---|---|
| PubChem CID | 139251427 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | tert-butyl-dimethyl-[(4S)-pentadec-1-en-14-yn-4-yl]oxysilane |
| SMILES | C#CCCCCCCCCC[C@@H](CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40OSi/c1-8-10-11-12-13-14-15-16-17-19-20(18-9-2)22-23(6,7)21(3,4)5/h1,9,20H,2,10-19H2,3-7H3/t20-/m1/s1 |
| InChIKey | NWROIFOCIDCBFI-HXUWFJFHSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|