C33H31F6NO2 — CID 134843065
3-[3-(trifluoromethyl)phenyl]propyl N-[(1R)-1-naphthalen-1-ylethyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]carbamate (PubChem CID 134843065) has the molecular formula C33H31F6NO2 and a molecular weight of 587.60 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]propyl N-[(1R)-1-naphthalen-1-ylethyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]carbamate.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]propyl N-[(1R)-1-naphthalen-1-ylethyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 134843065 |
| Molecular Formula | C33H31F6NO2 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]propyl N-[(1R)-1-naphthalen-1-ylethyl]-N-[3-[3-(trifluoromethyl)phenyl]propyl]carbamate |
| SMILES | C[C@H](c1cccc2ccccc12)N(CCCc1cccc(C(F)(F)F)c1)C(=O)OCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H31F6NO2/c1-23(29-18-6-14-26-13-2-3-17-30(26)29)40(19-7-11-24-9-4-15-27(21-24)32(34,35)36)31(41)42-20-8-12-25-10-5-16-28(22-25)33(37,38)39/h2-6,9-10,13-18,21-23H,7-8,11-12,19-20H2,1H3/t23-/m1/s1 |
| InChIKey | GJOPLRQGSXGLOL-HSZRJFAPSA-N |
| XLogP | 9.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|