C32H31F6NO — CID 138968144
1-[[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 138968144) has the molecular formula C32H31F6NO and a molecular weight of 559.59 g/mol. Its IUPAC name is 1-[[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 1-[[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 138968144 |
| Molecular Formula | C32H31F6NO |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 1-[[(1R)-1-naphthalen-1-ylethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | C[C@H](c1cccc2ccccc12)N(CCCc1cccc(C(F)(F)F)c1)C(O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H31F6NO/c1-22(28-16-6-12-25-11-2-3-15-29(25)28)39(19-7-10-23-8-4-13-26(20-23)31(33,34)35)30(40)18-17-24-9-5-14-27(21-24)32(36,37)38/h2-6,8-9,11-16,20-22,30,40H,7,10,17-19H2,1H3/t22-,30?/m1/s1 |
| InChIKey | UQCXXHWFMSIRPV-VWRCBCJMSA-N |
| XLogP | 8.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|