C29H45IO10 — CID 134843441
tert-butyl (E)-4-[(2S,4R,6R)-4-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-3-methoxy-6-methyloxan-2-yl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate (PubChem CID 134843441) has the molecular formula C29H45IO10 and a molecular weight of 680.57 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-3-methoxy-6-methyloxan-2-yl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-3-methoxy-6-methyloxan-2-yl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134843441 |
| Molecular Formula | C29H45IO10 |
| Molecular Weight | 680.57 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-3-methoxy-6-methyloxan-2-yl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
| SMILES | CO[C@H]1[C@H](O[C@@H]2C[C@H](C/C=C/C(=O)OC(C)(C)C)O[C@H](C[C@@H](C)/C=C/I)C2)O[C@@H](C)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H45IO10/c1-17(12-13-30)14-22-16-23(15-21(38-22)10-9-11-24(33)40-29(5,6)7)39-28-27(34-8)26(37-20(4)32)25(18(2)35-28)36-19(3)31/h9,11-13,17-18,21-23,25-28H,10,14-16H2,1-8H3/b11-9+,13-12+/t17-,18-,21-,22+,23+,25-,26+,27+,28-/m0/s1 |
| InChIKey | OQVOZPHZGQLHFF-HBIDLYDUSA-N |
| XLogP | 4.81 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|