C23H35IO8 — CID 139249729
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-[(E)-4-iodo-2-methylbut-3-en-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate (PubChem CID 139249729) has the molecular formula C23H35IO8 and a molecular weight of 566.43 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-[(E)-4-iodo-2-methylbut-3-en-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-[(E)-4-iodo-2-methylbut-3-en-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 139249729 |
| Molecular Formula | C23H35IO8 |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-[(E)-4-iodo-2-methylbut-3-en-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@H]2OC(C)(C)O[C@@H]2C)O[C@@](OC)(C(C)(C)/C=C/I)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H35IO8/c1-14-18(32-22(5,6)30-14)13-17-11-16(12-19(26)27-7)20(29-15(2)25)23(28-8,31-17)21(3,4)9-10-24/h9-10,12,14,17-18,20H,11,13H2,1-8H3/b10-9+,16-12+/t14-,17+,18-,20+,23-/m1/s1 |
| InChIKey | KHWOTSFECLTJON-QMTXLAAMSA-N |
| XLogP | 4.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|