C22H38O6 — CID 134971658
ethyl (2E)-2-[(4R)-4-[3-(2-hexyl-1,3-dioxolan-2-yl)propyl]-2,2-dimethyl-1,3-dioxan-5-ylidene]acetate (PubChem CID 134971658) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is ethyl (2E)-2-[(4R)-4-[3-(2-hexyl-1,3-dioxolan-2-yl)propyl]-2,2-dimethyl-1,3-dioxan-5-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(4R)-4-[3-(2-hexyl-1,3-dioxolan-2-yl)propyl]-2,2-dimethyl-1,3-dioxan-5-ylidene]acetate |
|---|---|
| PubChem CID | 134971658 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | ethyl (2E)-2-[(4R)-4-[3-(2-hexyl-1,3-dioxolan-2-yl)propyl]-2,2-dimethyl-1,3-dioxan-5-ylidene]acetate |
| SMILES | CCCCCCC1(CCC[C@H]2OC(C)(C)OC/C2=C\C(=O)OCC)OCCO1 |
| InChI | InChI=1S/C22H38O6/c1-5-7-8-9-12-22(25-14-15-26-22)13-10-11-19-18(16-20(23)24-6-2)17-27-21(3,4)28-19/h16,19H,5-15,17H2,1-4H3/b18-16+/t19-/m1/s1 |
| InChIKey | GWAHTXGHSVYWIV-WNZNBFKUSA-N |
| XLogP | 4.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|