C14H20O5 — CID 146684000
4-methoxy-6-[(2R,5R)-2-methoxy-5-propyloxolan-2-yl]pyran-2-one (PubChem CID 146684000) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-methoxy-6-[(2R,5R)-2-methoxy-5-propyloxolan-2-yl]pyran-2-one.
| Compound Name | 4-methoxy-6-[(2R,5R)-2-methoxy-5-propyloxolan-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 146684000 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-methoxy-6-[(2R,5R)-2-methoxy-5-propyloxolan-2-yl]pyran-2-one |
| SMILES | CCC[C@@H]1CC[C@](OC)(c2cc(OC)cc(=O)o2)O1 |
| InChI | InChI=1S/C14H20O5/c1-4-5-10-6-7-14(17-3,19-10)12-8-11(16-2)9-13(15)18-12/h8-10H,4-7H2,1-3H3/t10-,14-/m1/s1 |
| InChIKey | JARSXHJNYYXQHS-QMTHXVAHSA-N |
| XLogP | 2.43 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |